EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H9ClN2O2 |
| Net Charge | 0 |
| Average Mass | 272.691 |
| Monoisotopic Mass | 272.03526 |
| SMILES | O=C(Oc1cncc(Cl)c1)c1ccc2nccc2c1 |
| InChI | InChI=1S/C14H9ClN2O2/c15-11-6-12(8-16-7-11)19-14(18)10-1-2-13-9(5-10)3-4-17-13/h1-8,17H |
| InChIKey | TYLOEMFGLQBHPE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5-Chloropyridin-3-yl) 1H-indole-5-carboxylate (CHEBI:149981) has role anticoronaviral agent (CHEBI:149553) |
| (5-Chloropyridin-3-yl) 1H-indole-5-carboxylate (CHEBI:149981) is a indolyl carboxylic acid (CHEBI:46867) |