EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13Cl2NO2S |
| Net Charge | 0 |
| Average Mass | 342.247 |
| Monoisotopic Mass | 341.00441 |
| SMILES | O=C1CCSC(c2c(Cl)cccc2Cl)N1Cc1ccco1 |
| InChI | InChI=1S/C15H13Cl2NO2S/c16-11-4-1-5-12(17)14(11)15-18(13(19)6-8-21-15)9-10-3-2-7-20-10/h1-5,7,15H,6,8-9H2 |
| InChIKey | DSELIJRCRNKWIU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2,6-Dichlorophenyl)-3-(2-furylmethyl)-1,3-thiazinan-4-one (CHEBI:149979) has role anticoronaviral agent (CHEBI:149553) |
| 2-(2,6-Dichlorophenyl)-3-(2-furylmethyl)-1,3-thiazinan-4-one (CHEBI:149979) is a dichlorobenzene (CHEBI:23697) |