EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15NO4 |
| Net Charge | 0 |
| Average Mass | 297.310 |
| Monoisotopic Mass | 297.10011 |
| SMILES | O=C(O)/C(O)=C/C(=O)c1cccc(NCc2ccccc2)c1 |
| InChI | InChI=1S/C17H15NO4/c19-15(10-16(20)17(21)22)13-7-4-8-14(9-13)18-11-12-5-2-1-3-6-12/h1-10,18,20H,11H2,(H,21,22)/b16-10- |
| InChIKey | ASIWCVUPDPRPDL-YBEGLDIGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CHEMBL492571 (CHEBI:149973) has role anticoronaviral agent (CHEBI:149553) |
| CHEMBL492571 (CHEBI:149973) is a aromatic amine (CHEBI:33860) |