EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N3OS |
| Net Charge | 0 |
| Average Mass | 313.426 |
| Monoisotopic Mass | 313.12488 |
| SMILES | Cc1cccc(N2C(=O)CSC2c2ccc(N(C)C)cc2)n1 |
| InChI | InChI=1S/C17H19N3OS/c1-12-5-4-6-15(18-12)20-16(21)11-22-17(20)13-7-9-14(10-8-13)19(2)3/h4-10,17H,11H2,1-3H3 |
| InChIKey | ICPKWHMLZNJYKV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(4-Dimethylaminophenyl)-3-(6-methyl-2-pyridyl)thiazolidin-4-one (CHEBI:149967) has role anticoronaviral agent (CHEBI:149553) |
| 2-(4-Dimethylaminophenyl)-3-(6-methyl-2-pyridyl)thiazolidin-4-one (CHEBI:149967) is a dialkylarylamine (CHEBI:23665) |
| 2-(4-Dimethylaminophenyl)-3-(6-methyl-2-pyridyl)thiazolidin-4-one (CHEBI:149967) is a tertiary amino compound (CHEBI:50996) |