EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H11Cl2NO2S |
| Net Charge | 0 |
| Average Mass | 328.220 |
| Monoisotopic Mass | 326.98875 |
| SMILES | O=C1CSC(c2c(Cl)cccc2Cl)N1Cc1ccco1 |
| InChI | InChI=1S/C14H11Cl2NO2S/c15-10-4-1-5-11(16)13(10)14-17(12(18)8-20-14)7-9-3-2-6-19-9/h1-6,14H,7-8H2 |
| InChIKey | RDGDIVQKAVGUJX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Thiazolidinone, 2-(2,6-dichlorophenyl)-3-(2-furanylmethyl)- (CHEBI:149965) has role anticoronaviral agent (CHEBI:149553) |
| 4-Thiazolidinone, 2-(2,6-dichlorophenyl)-3-(2-furanylmethyl)- (CHEBI:149965) is a dichlorobenzene (CHEBI:23697) |