EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10Br2F3N3OS |
| Net Charge | 0 |
| Average Mass | 497.134 |
| Monoisotopic Mass | 494.88634 |
| SMILES | Cc1cc(C(F)(F)F)nc(N2C(=O)CSC2c2c(Br)cccc2Br)n1 |
| InChI | InChI=1S/C15H10Br2F3N3OS/c1-7-5-10(15(18,19)20)22-14(21-7)23-11(24)6-25-13(23)12-8(16)3-2-4-9(12)17/h2-5,13H,6H2,1H3 |
| InChIKey | MXDXPXDVTLJQTC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2,6-Dibromophenyl)-3-(4-methyl-6-trifluoromethylpyrimidin-2-yl)thiazolidin-4-one (CHEBI:149963) has role anticoronaviral agent (CHEBI:149553) |
| 2-(2,6-Dibromophenyl)-3-(4-methyl-6-trifluoromethylpyrimidin-2-yl)thiazolidin-4-one (CHEBI:149963) is a organobromine compound (CHEBI:37141) |