EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H12ClFN2OS |
| Net Charge | 0 |
| Average Mass | 358.825 |
| Monoisotopic Mass | 358.03429 |
| SMILES | O=C1CSC(c2c(F)cccc2Cl)N1c1ccc2ccccc2n1 |
| InChI | InChI=1S/C18H12ClFN2OS/c19-12-5-3-6-13(20)17(12)18-22(16(23)10-24-18)15-9-8-11-4-1-2-7-14(11)21-15/h1-9,18H,10H2 |
| InChIKey | YCCHQUOMZVHIOW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2-Chloro-6-fluoro-phenyl)-3-(2-quinolyl)thiazolidin-4-one (CHEBI:149962) has role anticoronaviral agent (CHEBI:149553) |
| 2-(2-Chloro-6-fluoro-phenyl)-3-(2-quinolyl)thiazolidin-4-one (CHEBI:149962) is a quinolines (CHEBI:26513) |