EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N3OS |
| Net Charge | 0 |
| Average Mass | 299.399 |
| Monoisotopic Mass | 299.10923 |
| SMILES | CN(C)c1ccc(C2SCC(=O)N2c2ccccn2)cc1 |
| InChI | InChI=1S/C16H17N3OS/c1-18(2)13-8-6-12(7-9-13)16-19(15(20)11-21-16)14-5-3-4-10-17-14/h3-10,16H,11H2,1-2H3 |
| InChIKey | PSSIXVHSZSMVOK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(4-Dimethylaminophenyl)-3-(2-pyridyl)thiazolidin-4-one (CHEBI:149958) has role anticoronaviral agent (CHEBI:149553) |
| 2-(4-Dimethylaminophenyl)-3-(2-pyridyl)thiazolidin-4-one (CHEBI:149958) is a dialkylarylamine (CHEBI:23665) |
| 2-(4-Dimethylaminophenyl)-3-(2-pyridyl)thiazolidin-4-one (CHEBI:149958) is a tertiary amino compound (CHEBI:50996) |