EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H27FN4O2 |
| Net Charge | 0 |
| Average Mass | 470.548 |
| Monoisotopic Mass | 470.21180 |
| SMILES | CCOC(=O)C1(Cc2ccccc2)CN(c2ccccc2)Cc2nnn(Cc3ccc(F)cc3)c21 |
| InChI | InChI=1S/C28H27FN4O2/c1-2-35-27(34)28(17-21-9-5-3-6-10-21)20-32(24-11-7-4-8-12-24)19-25-26(28)33(31-30-25)18-22-13-15-23(29)16-14-22/h3-16H,2,17-20H2,1H3 |
| InChIKey | HNPXJDFVFVHUPC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ethyl 7-benzyl-1-[(4-fluorophenyl)methyl]-5-phenyl-4,6-dihydrotriazolo[4,5-c]pyridine-7-carboxylate (CHEBI:149952) has role anticoronaviral agent (CHEBI:149553) |
| Ethyl 7-benzyl-1-[(4-fluorophenyl)methyl]-5-phenyl-4,6-dihydrotriazolo[4,5-c]pyridine-7-carboxylate (CHEBI:149952) is a triazolopyridine (CHEBI:46746) |