EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25ClN3O6P |
| Net Charge | 0 |
| Average Mass | 517.906 |
| Monoisotopic Mass | 517.11695 |
| SMILES | C[C@H](NP(=O)(C/C=C/Cn1cc(Cl)c(=O)nc1=O)Oc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H25ClN3O6P/c1-18(23(30)33-17-19-10-4-2-5-11-19)27-35(32,34-20-12-6-3-7-13-20)15-9-8-14-28-16-21(25)22(29)26-24(28)31/h2-13,16,18H,14-15,17H2,1H3,(H,27,32)(H,26,29,31)/b9-8+/t18-,35?/m0/s1 |
| InChIKey | HPFPJPBJRGTRHI-HRRFIACWSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Benzyl (2S)-2-[[[(E)-4-(5-chloro-2,4-dioxopyrimidin-1-yl)but-2-enyl]-phenoxyphosphoryl]amino]propanoate (CHEBI:149934) has role anticoronaviral agent (CHEBI:149553) |
| Benzyl (2S)-2-[[[(E)-4-(5-chloro-2,4-dioxopyrimidin-1-yl)but-2-enyl]-phenoxyphosphoryl]amino]propanoate (CHEBI:149934) is a α-amino acid ester (CHEBI:46874) |