EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O2 |
| Net Charge | 0 |
| Average Mass | 238.371 |
| Monoisotopic Mass | 238.19328 |
| SMILES | [H][C@@]12CC[C@@H](C)[C@@]13CC[C@@](C)(O)[C@]([H])(C3)[C@]2(C)CO |
| InChI | InChI=1S/C15H26O2/c1-10-4-5-11-13(2,9-16)12-8-15(10,11)7-6-14(12,3)17/h10-12,16-17H,4-9H2,1-3H3/t10-,11+,12-,13-,14-,15+/m1/s1 |
| InChIKey | YULHLOUAHSEHLD-FVUFVHQMSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,2R,5R,6R,7R,8R)-6-(Hydroxymethyl)-2,6,8-trimethyltricyclo[5.3.1.01,5]undecan-8-ol (CHEBI:149922) has role anticoronaviral agent (CHEBI:149553) |
| (1S,2R,5R,6R,7R,8R)-6-(Hydroxymethyl)-2,6,8-trimethyltricyclo[5.3.1.01,5]undecan-8-ol (CHEBI:149922) is a cedrane sesquiterpenoid (CHEBI:36745) |