EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H12Cl2F3N3OS |
| Net Charge | 0 |
| Average Mass | 470.303 |
| Monoisotopic Mass | 469.00302 |
| SMILES | O=C1CSC(c2c(Cl)cccc2Cl)N1c1nc(-c2ccccc2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C20H12Cl2F3N3OS/c21-12-7-4-8-13(22)17(12)18-28(16(29)10-30-18)19-26-14(11-5-2-1-3-6-11)9-15(27-19)20(23,24)25/h1-9,18H,10H2 |
| InChIKey | FNWZBSYDEOGGJU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2,6-Dichlorophenyl)-3-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]thiazolidin-4-one (CHEBI:149920) has role anticoronaviral agent (CHEBI:149553) |
| 2-(2,6-Dichlorophenyl)-3-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]thiazolidin-4-one (CHEBI:149920) is a pyrimidines (CHEBI:39447) |