EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H15ClFN3OS |
| Net Charge | 0 |
| Average Mass | 399.878 |
| Monoisotopic Mass | 399.06084 |
| SMILES | Cc1cc(-c2ccccc2)nc(N2C(=O)CSC2c2c(F)cccc2Cl)n1 |
| InChI | InChI=1S/C20H15ClFN3OS/c1-12-10-16(13-6-3-2-4-7-13)24-20(23-12)25-17(26)11-27-19(25)18-14(21)8-5-9-15(18)22/h2-10,19H,11H2,1H3 |
| InChIKey | OTPCDAXONNMWAO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2-Chloro-6-fluoro-phenyl)-3-(4-methyl-6-phenyl-pyrimidin-2-yl)thiazolidin-4-one (CHEBI:149919) has role anticoronaviral agent (CHEBI:149553) |
| 2-(2-Chloro-6-fluoro-phenyl)-3-(4-methyl-6-phenyl-pyrimidin-2-yl)thiazolidin-4-one (CHEBI:149919) is a pyrimidines (CHEBI:39447) |