EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H26N2O4 |
| Net Charge | 0 |
| Average Mass | 490.559 |
| Monoisotopic Mass | 490.18926 |
| SMILES | CC(C)(C)c1ccc(N2N=C(c3ccccc3)/C(=C/c3ccc(-c4ccccc4C(=O)O)o3)C2=O)cc1 |
| InChI | InChI=1S/C31H26N2O4/c1-31(2,3)21-13-15-22(16-14-21)33-29(34)26(28(32-33)20-9-5-4-6-10-20)19-23-17-18-27(37-23)24-11-7-8-12-25(24)30(35)36/h4-19H,1-3H3,(H,35,36)/b26-19- |
| InChIKey | XWFZHLYIOFAQRH-XHPQRKPJSA-N |
| Roles Classification |
|---|
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[5-[(Z)-[1-(4-Tert-butylphenyl)-5-oxo-3-phenylpyrazol-4-ylidene]methyl]furan-2-yl]benzoic acid (CHEBI:149913) has role anticoronaviral agent (CHEBI:149553) |
| 2-[5-[(Z)-[1-(4-Tert-butylphenyl)-5-oxo-3-phenylpyrazol-4-ylidene]methyl]furan-2-yl]benzoic acid (CHEBI:149913) is a diarylheptanoid (CHEBI:78802) |