EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H20N2O3 |
| Net Charge | 0 |
| Average Mass | 444.490 |
| Monoisotopic Mass | 444.14739 |
| SMILES | O=C(O)c1cccc(N2N=C(c3ccccc3)/C(=C/c3ccc(-c4ccccc4)cc3)C2=O)c1 |
| InChI | InChI=1S/C29H20N2O3/c32-28-26(18-20-14-16-22(17-15-20)21-8-3-1-4-9-21)27(23-10-5-2-6-11-23)30-31(28)25-13-7-12-24(19-25)29(33)34/h1-19H,(H,33,34)/b26-18- |
| InChIKey | BWJHOHOWSONGSI-ITYLOYPMSA-N |
| Roles Classification |
|---|
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[(4Z)-5-Oxo-3-phenyl-4-[(4-phenylphenyl)methylidene]pyrazol-1-yl]benzoic acid (CHEBI:149911) has role anticoronaviral agent (CHEBI:149553) |
| 3-[(4Z)-5-Oxo-3-phenyl-4-[(4-phenylphenyl)methylidene]pyrazol-1-yl]benzoic acid (CHEBI:149911) is a diarylheptanoid (CHEBI:78802) |