EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H12O3 |
| Net Charge | 0 |
| Average Mass | 276.291 |
| Monoisotopic Mass | 276.07864 |
| SMILES | Cc1coc2c1C(=O)C(=O)c1c-2ccc2c(C)cccc12 |
| InChI | InChI=1S/C18H12O3/c1-9-4-3-5-12-11(9)6-7-13-15(12)17(20)16(19)14-10(2)8-21-18(13)14/h3-8H,1-2H3 |
| InChIKey | AIGAZQPHXLWMOJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tanshinone I (CHEBI:149906) has role anticoronaviral agent (CHEBI:149553) |
| Tanshinone I (CHEBI:149906) is a abietane diterpenoid (CHEBI:36762) |
| Synonym | Source |
|---|---|
| Tanshinone | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:568-73-0 | ChemIDplus |