EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H14N2O3 |
| Net Charge | 0 |
| Average Mass | 330.343 |
| Monoisotopic Mass | 330.10044 |
| SMILES | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H14N2O3/c21-19(24)15-7-8-17-16(10-15)18(23)20(25)22(17)11-12-5-6-13-3-1-2-4-14(13)9-12/h1-10H,11H2,(H2,21,24) |
| InChIKey | NTNYHMJYSGPGCQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(2-Naphthylmethyl)-2,3-dioxo-indoline-5-carboxamide (CHEBI:149905) has role anticoronaviral agent (CHEBI:149553) |
| 1-(2-Naphthylmethyl)-2,3-dioxo-indoline-5-carboxamide (CHEBI:149905) is a indolecarboxamide (CHEBI:46921) |