EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H4ClNO2 |
| Net Charge | 0 |
| Average Mass | 181.578 |
| Monoisotopic Mass | 180.99306 |
| SMILES | O=C1Nc2ccc(Cl)cc2C1=O |
| InChI | InChI=1S/C8H4ClNO2/c9-4-1-2-6-5(3-4)7(11)8(12)10-6/h1-3H,(H,10,11,12) |
| InChIKey | XHDJYQWGFIBCEP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Chloro-1H-indole-2,3-dione (CHEBI:149904) has role anticoronaviral agent (CHEBI:149553) |
| 5-Chloro-1H-indole-2,3-dione (CHEBI:149904) is a indoles (CHEBI:24828) |