EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19N5O4 |
| Net Charge | 0 |
| Average Mass | 369.381 |
| Monoisotopic Mass | 369.14370 |
| SMILES | COc1cc(/C=N\NC(=O)Cn2nnc3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C18H19N5O4/c1-25-15-8-12(9-16(26-2)18(15)27-3)10-19-21-17(24)11-23-14-7-5-4-6-13(14)20-22-23/h4-10H,11H2,1-3H3,(H,21,24)/b19-10- |
| InChIKey | MVYPWRQAXNXLAH-GRSHGNNSSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(1H-1,2,3-Benzotriazol-1-yl)-N'-(3,4,5-trimethoxybenzylidene)acetohydrazide (CHEBI:149899) has role anticoronaviral agent (CHEBI:149553) |
| 2-(1H-1,2,3-Benzotriazol-1-yl)-N'-(3,4,5-trimethoxybenzylidene)acetohydrazide (CHEBI:149899) is a benzotriazoles (CHEBI:48912) |