EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10Cl2N2S3 |
| Net Charge | 0 |
| Average Mass | 349.333 |
| Monoisotopic Mass | 347.93832 |
| SMILES | S=C(NCc1cccnc1)SCc1cc(Cl)sc1Cl |
| InChI | InChI=1S/C12H10Cl2N2S3/c13-10-4-9(11(14)19-10)7-18-12(17)16-6-8-2-1-3-15-5-8/h1-5H,6-7H2,(H,16,17) |
| InChIKey | DGYDYUNBWSVWEX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2,5-Dichlorothiophen-3-yl)methyl N-(pyridin-3-ylmethyl)carbamodithioate (CHEBI:149896) has role anticoronaviral agent (CHEBI:149553) |
| (2,5-Dichlorothiophen-3-yl)methyl N-(pyridin-3-ylmethyl)carbamodithioate (CHEBI:149896) is a thiophenes (CHEBI:26961) |