EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16N2O4S |
| Net Charge | 0 |
| Average Mass | 308.359 |
| Monoisotopic Mass | 308.08308 |
| SMILES | CC1CCCCN1S(=O)(=O)c1ccc2c(c1)C(=O)C(=O)N2 |
| InChI | InChI=1S/C14H16N2O4S/c1-9-4-2-3-7-16(9)21(19,20)10-5-6-12-11(8-10)13(17)14(18)15-12/h5-6,8-9H,2-4,7H2,1H3,(H,15,17,18) |
| InChIKey | GYYSCINPBSJGRR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(2-Methylpiperidin-1-yl)sulfonyl-1H-indole-2,3-dione (CHEBI:149894) has role anticoronaviral agent (CHEBI:149553) |
| 5-(2-Methylpiperidin-1-yl)sulfonyl-1H-indole-2,3-dione (CHEBI:149894) is a indoles (CHEBI:24828) |