EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H9NO2 |
| Net Charge | 0 |
| Average Mass | 187.198 |
| Monoisotopic Mass | 187.06333 |
| SMILES | O=C1Nc2cc3c(cc2C1=O)CCC3 |
| InChI | InChI=1S/C11H9NO2/c13-10-8-4-6-2-1-3-7(6)5-9(8)12-11(10)14/h4-5H,1-3H2,(H,12,13,14) |
| InChIKey | BNNNCGOCFKVAEM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyclopent[f]indole-2,3-dione, 1,5,6,7-tetrahydro- (CHEBI:149891) has role anticoronaviral agent (CHEBI:149553) |
| Cyclopent[f]indole-2,3-dione, 1,5,6,7-tetrahydro- (CHEBI:149891) is a indoles (CHEBI:24828) |