EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H7NO3 |
| Net Charge | 0 |
| Average Mass | 189.170 |
| Monoisotopic Mass | 189.04259 |
| SMILES | CC(=O)c1ccc2c(c1)C(=O)C(=O)N2 |
| InChI | InChI=1S/C10H7NO3/c1-5(12)6-2-3-8-7(4-6)9(13)10(14)11-8/h2-4H,1H3,(H,11,13,14) |
| InChIKey | AZGVVLJKUZCTMV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1H-Indole-2,3-dione, 5-acetyl- (CHEBI:149890) has role anticoronaviral agent (CHEBI:149553) |
| 1H-Indole-2,3-dione, 5-acetyl- (CHEBI:149890) is a indoles (CHEBI:24828) |