EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N2O4S |
| Net Charge | 0 |
| Average Mass | 336.413 |
| Monoisotopic Mass | 336.11438 |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc3c(c2)C(=O)C(=O)N3C)C1 |
| InChI | InChI=1S/C16H20N2O4S/c1-10-6-11(2)9-18(8-10)23(21,22)12-4-5-14-13(7-12)15(19)16(20)17(14)3/h4-5,7,10-11H,6,8-9H2,1-3H3 |
| InChIKey | IDNPHGVHLGZACH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(3,5-Dimethylpiperidin-1-yl)sulfonyl-1-methylindole-2,3-dione (CHEBI:149888) has role anticoronaviral agent (CHEBI:149553) |
| 5-(3,5-Dimethylpiperidin-1-yl)sulfonyl-1-methylindole-2,3-dione (CHEBI:149888) is a indoles (CHEBI:24828) |