EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11F2N3OS2 |
| Net Charge | 0 |
| Average Mass | 327.381 |
| Monoisotopic Mass | 327.03116 |
| SMILES | CCc1nnc(N2C(=O)CSC2c2c(F)cccc2F)s1 |
| InChI | InChI=1S/C13H11F2N3OS2/c1-2-9-16-17-13(21-9)18-10(19)6-20-12(18)11-7(14)4-3-5-8(11)15/h3-5,12H,2,6H2,1H3 |
| InChIKey | FBIDJKGYZQWZPX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2,6-Difluorophenyl)-3-(5-ethyl-1,3,4-thiadiazol-2-yl)thiazolidin-4-one (CHEBI:149883) has role anticoronaviral agent (CHEBI:149553) |
| 2-(2,6-Difluorophenyl)-3-(5-ethyl-1,3,4-thiadiazol-2-yl)thiazolidin-4-one (CHEBI:149883) is a organofluorine compound (CHEBI:37143) |