EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32O4 |
| Net Charge | 0 |
| Average Mass | 384.516 |
| Monoisotopic Mass | 384.23006 |
| SMILES | [H][C@@]12C=Cc3cc(C(C)C)c(OC(C)=O)cc3[C@@]1(C)CC[C@H](OC(C)=O)C2(C)C |
| InChI | InChI=1S/C24H32O4/c1-14(2)18-12-17-8-9-21-23(5,6)22(28-16(4)26)10-11-24(21,7)19(17)13-20(18)27-15(3)25/h8-9,12-14,21-22H,10-11H2,1-7H3/t21-,22-,24+/m0/s1 |
| InChIKey | INFKGIQNEZSZMS-WPFOTENUSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(2S,4As,10aR)-6-acetyloxy-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,10a-tetrahydrophenanthren-2-yl] acetate (CHEBI:149878) has role anticoronaviral agent (CHEBI:149553) |
| [(2S,4As,10aR)-6-acetyloxy-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,10a-tetrahydrophenanthren-2-yl] acetate (CHEBI:149878) is a diterpenoid (CHEBI:23849) |