EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H14O3 |
| Net Charge | 0 |
| Average Mass | 278.307 |
| Monoisotopic Mass | 278.09429 |
| SMILES | Cc1cccc2c3c(ccc12)C1=C(C(=O)C3=O)[C@@H](C)CO1 |
| InChI | InChI=1S/C18H14O3/c1-9-4-3-5-12-11(9)6-7-13-15(12)17(20)16(19)14-10(2)8-21-18(13)14/h3-7,10H,8H2,1-2H3/t10-/m0/s1 |
| InChIKey | HARGZZNYNSYSGJ-JTQLQIEISA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dihydrotanshinone I (CHEBI:149872) has role anticoronaviral agent (CHEBI:149553) |
| Dihydrotanshinone I (CHEBI:149872) is a abietane diterpenoid (CHEBI:36762) |
| Registry Numbers | Sources |
|---|---|
| CAS:87205-99-0 | ChemIDplus |