EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H4BrNO2 |
| Net Charge | 0 |
| Average Mass | 226.029 |
| Monoisotopic Mass | 224.94254 |
| SMILES | O=C1Nc2cccc(Br)c2C1=O |
| InChI | InChI=1S/C8H4BrNO2/c9-4-2-1-3-5-6(4)7(11)8(12)10-5/h1-3H,(H,10,11,12) |
| InChIKey | ITRAKBJPMLKWIW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Bromoisatin (CHEBI:149871) has role anticoronaviral agent (CHEBI:149553) |
| 4-Bromoisatin (CHEBI:149871) is a indoles (CHEBI:24828) |