EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8ClNO2S |
| Net Charge | 0 |
| Average Mass | 289.743 |
| Monoisotopic Mass | 288.99643 |
| SMILES | O=C(Oc1cncc(Cl)c1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C14H8ClNO2S/c15-10-6-11(8-16-7-10)18-14(17)13-5-9-3-1-2-4-12(9)19-13/h1-8H |
| InChIKey | MNUHXGJUYTWVLU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Chloropyridin-3-yl benzo[b]thiophene-2-carboxylate (CHEBI:149867) has role anticoronaviral agent (CHEBI:149553) |
| 5-Chloropyridin-3-yl benzo[b]thiophene-2-carboxylate (CHEBI:149867) is a 1-benzothiophenes (CHEBI:38836) |