EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H9Cl2NO3 |
| Net Charge | 0 |
| Average Mass | 334.158 |
| Monoisotopic Mass | 332.99595 |
| SMILES | O=C(Oc1cncc(Cl)c1)c1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C16H9Cl2NO3/c17-11-3-1-10(2-4-11)14-5-6-15(22-14)16(20)21-13-7-12(18)8-19-9-13/h1-9H |
| InChIKey | UICFGOSRHHZBHZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Chloropyridin-3-yl 5-(4-chlorophenyl)furan-2-carboxylate (CHEBI:149865) has functional parent 2-furoic acid (CHEBI:30845) |
| 5-Chloropyridin-3-yl 5-(4-chlorophenyl)furan-2-carboxylate (CHEBI:149865) has role anticoronaviral agent (CHEBI:149553) |
| 5-Chloropyridin-3-yl 5-(4-chlorophenyl)furan-2-carboxylate (CHEBI:149865) is a carboxylic ester (CHEBI:33308) |