EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7NO3 |
| Net Charge | 0 |
| Average Mass | 177.159 |
| Monoisotopic Mass | 177.04259 |
| SMILES | COc1ccc2c(c1)C(=O)C(=O)N2 |
| InChI | InChI=1S/C9H7NO3/c1-13-5-2-3-7-6(4-5)8(11)9(12)10-7/h2-4H,1H3,(H,10,11,12) |
| InChIKey | DMHGXMPXHPOXBF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Methoxyisatin (CHEBI:149863) has role anticoronaviral agent (CHEBI:149553) |
| 5-Methoxyisatin (CHEBI:149863) is a indoles (CHEBI:24828) |
| Registry Numbers | Sources |
|---|---|
| CAS:39755-95-8 | ChemIDplus |