EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H5ClN2O2S |
| Net Charge | 0 |
| Average Mass | 240.671 |
| Monoisotopic Mass | 239.97603 |
| SMILES | O=C(Oc1cncc(Cl)c1)c1cscn1 |
| InChI | InChI=1S/C9H5ClN2O2S/c10-6-1-7(3-11-2-6)14-9(13)8-4-15-5-12-8/h1-5H |
| InChIKey | CSEAAOWXHPFATP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Chloropyridin-3-yl thiazole-4-carboxylate (CHEBI:149862) has role anticoronaviral agent (CHEBI:149553) |
| 5-Chloropyridin-3-yl thiazole-4-carboxylate (CHEBI:149862) is a aromatic carboxylic acid (CHEBI:33859) |
| 5-Chloropyridin-3-yl thiazole-4-carboxylate (CHEBI:149862) is a thiazoles (CHEBI:48901) |