EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H6BrNO3 |
| Net Charge | 0 |
| Average Mass | 268.066 |
| Monoisotopic Mass | 266.95311 |
| SMILES | O=C(Oc1cncc(Br)c1)c1ccco1 |
| InChI | InChI=1S/C10H6BrNO3/c11-7-4-8(6-12-5-7)15-10(13)9-2-1-3-14-9/h1-6H |
| InChIKey | HMICIXHTRIFAET-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Bromopyridin-3-yl furan-2-carboxylate (CHEBI:149861) has functional parent 2-furoic acid (CHEBI:30845) |
| 5-Bromopyridin-3-yl furan-2-carboxylate (CHEBI:149861) has role anticoronaviral agent (CHEBI:149553) |
| 5-Bromopyridin-3-yl furan-2-carboxylate (CHEBI:149861) is a carboxylic ester (CHEBI:33308) |