EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H7NO2S |
| Net Charge | 0 |
| Average Mass | 205.238 |
| Monoisotopic Mass | 205.01975 |
| SMILES | O=C(Oc1cccnc1)c1cccs1 |
| InChI | InChI=1S/C10H7NO2S/c12-10(9-4-2-6-14-9)13-8-3-1-5-11-7-8/h1-7H |
| InChIKey | GVVPOBOYVLCUFS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyridin-3-yl thiophene-2-carboxylate (CHEBI:149860) has role anticoronaviral agent (CHEBI:149553) |
| Pyridin-3-yl thiophene-2-carboxylate (CHEBI:149860) is a thiophenecarboxylic acid (CHEBI:48436) |