EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9ClN4O2S |
| Net Charge | 0 |
| Average Mass | 284.728 |
| Monoisotopic Mass | 284.01347 |
| SMILES | Nc1ncc(S(=O)(=O)c2ccc(Cl)cc2)c(N)n1 |
| InChI | InChI=1S/C10H9ClN4O2S/c11-6-1-3-7(4-2-6)18(16,17)8-5-14-10(13)15-9(8)12/h1-5H,(H4,12,13,14,15) |
| InChIKey | RPPFHWBHHCJZJS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(4-Chloro-benzenesulfonyl)-pyrimidine-2,4-diamine (CHEBI:149858) has role anticoronaviral agent (CHEBI:149553) |
| 5-(4-Chloro-benzenesulfonyl)-pyrimidine-2,4-diamine (CHEBI:149858) is a sulfonic acid derivative (CHEBI:33552) |