EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H14Cl2N4OS2 |
| Net Charge | 0 |
| Average Mass | 473.410 |
| Monoisotopic Mass | 471.99861 |
| SMILES | O=C(CSc1nccc(-c2csc(-c3ccccc3)n2)n1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C21H14Cl2N4OS2/c22-14-8-15(23)10-16(9-14)25-19(28)12-30-21-24-7-6-17(27-21)18-11-29-20(26-18)13-4-2-1-3-5-13/h1-11H,12H2,(H,25,28) |
| InChIKey | LILOEJREEQFTPM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(3,5-Dichlorophenyl)-2-[4-(2-phenyl-1,3-thiazol-4-yl)pyrimidin-2-yl]sulfanylacetamide (CHEBI:149851) has role anticoronaviral agent (CHEBI:149553) |
| N-(3,5-Dichlorophenyl)-2-[4-(2-phenyl-1,3-thiazol-4-yl)pyrimidin-2-yl]sulfanylacetamide (CHEBI:149851) is a anilide (CHEBI:13248) |