EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H5NO4 |
| Net Charge | 0 |
| Average Mass | 191.142 |
| Monoisotopic Mass | 191.02186 |
| SMILES | O=C1Nc2ccc(C(=O)O)cc2C1=O |
| InChI | InChI=1S/C9H5NO4/c11-7-5-3-4(9(13)14)1-2-6(5)10-8(7)12/h1-3H,(H,13,14)(H,10,11,12) |
| InChIKey | SNPPWTIGLNZFRF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-Dioxoindoline-5-carboxylic acid (CHEBI:149850) has role anticoronaviral agent (CHEBI:149553) |
| 2,3-Dioxoindoline-5-carboxylic acid (CHEBI:149850) is a indolyl carboxylic acid (CHEBI:46867) |