EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32FN3O5 |
| Net Charge | 0 |
| Average Mass | 437.512 |
| Monoisotopic Mass | 437.23260 |
| SMILES | CCC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)NC(CCC(=O)N(C)C)C(=O)CF |
| InChI | InChI=1S/C22H32FN3O5/c1-5-15(2)20(25-22(30)31-14-16-9-7-6-8-10-16)21(29)24-17(18(27)13-23)11-12-19(28)26(3)4/h6-10,15,17,20H,5,11-14H2,1-4H3,(H,24,29)(H,25,30)/t15?,17?,20-/m0/s1 |
| InChIKey | RKGZUGUTFRGBHD-LAGYLCCXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Benzyl N-[(2S)-1-[[6-(dimethylamino)-1-fluoro-2,6-dioxohexan-3-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamate (CHEBI:149849) has role anticoronaviral agent (CHEBI:149553) |
| Benzyl N-[(2S)-1-[[6-(dimethylamino)-1-fluoro-2,6-dioxohexan-3-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamate (CHEBI:149849) is a peptide (CHEBI:16670) |