EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21N3O6 |
| Net Charge | 0 |
| Average Mass | 363.370 |
| Monoisotopic Mass | 363.14304 |
| SMILES | CCOC(=O)[C@H]1N[C@@H]1C(=O)NCC(=O)NCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H21N3O6/c1-2-25-17(24)15-14(20-15)16(23)19-8-12(21)18-9-13(22)26-10-11-6-4-3-5-7-11/h3-7,14-15,20H,2,8-10H2,1H3,(H,18,21)(H,19,23)/t14-,15-/m0/s1 |
| InChIKey | KRZXMZVPCISRBZ-GJZGRUSLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ethyl (2S,3S)-3-[[2-oxo-2-[(2-oxo-2-phenylmethoxyethyl)amino]ethyl]carbamoyl]aziridine-2-carboxylate (CHEBI:149846) has role anticoronaviral agent (CHEBI:149553) |
| Ethyl (2S,3S)-3-[[2-oxo-2-[(2-oxo-2-phenylmethoxyethyl)amino]ethyl]carbamoyl]aziridine-2-carboxylate (CHEBI:149846) is a oligopeptide (CHEBI:25676) |