EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19ClN2O3S |
| Net Charge | 0 |
| Average Mass | 330.837 |
| Monoisotopic Mass | 330.08049 |
| SMILES | CN(CC(=O)NC1CCCC1)S(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H19ClN2O3S/c1-17(10-14(18)16-12-6-2-3-7-12)21(19,20)13-8-4-5-11(15)9-13/h4-5,8-9,12H,2-3,6-7,10H2,1H3,(H,16,18) |
| InChIKey | AQPUOWMWVSBUSI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Cyclopentyl-2-(N-methyl3-chlorobenzenesulfonamido)acetamide (CHEBI:149841) has role anticoronaviral agent (CHEBI:149553) |
| N-Cyclopentyl-2-(N-methyl3-chlorobenzenesulfonamido)acetamide (CHEBI:149841) is a sulfonamide (CHEBI:35358) |