EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H11N3O3 |
| Net Charge | 0 |
| Average Mass | 281.271 |
| Monoisotopic Mass | 281.08004 |
| SMILES | Cc1noc(C)c1CN1C(=O)C(=O)c2cc(C#N)ccc21 |
| InChI | InChI=1S/C15H11N3O3/c1-8-12(9(2)21-17-8)7-18-13-4-3-10(6-16)5-11(13)14(19)15(18)20/h3-5H,7H2,1-2H3 |
| InChIKey | AGHODQJTQBGFTA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[(3,5-Dimethyl-1,2-oxazol-4-yl)methyl]-2,3-dioxoindole-5-carbonitrile (CHEBI:149839) has role anticoronaviral agent (CHEBI:149553) |
| 1-[(3,5-Dimethyl-1,2-oxazol-4-yl)methyl]-2,3-dioxoindole-5-carbonitrile (CHEBI:149839) is a indoles (CHEBI:24828) |