EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20O3 |
| Net Charge | 0 |
| Average Mass | 296.366 |
| Monoisotopic Mass | 296.14124 |
| SMILES | C[C@H]1COC2=C1C(=O)C(=O)c1c2ccc2c1CCCC2(C)C |
| InChI | InChI=1S/C19H20O3/c1-10-9-22-18-12-6-7-13-11(5-4-8-19(13,2)3)15(12)17(21)16(20)14(10)18/h6-7,10H,4-5,8-9H2,1-3H3/t10-/m0/s1 |
| InChIKey | GVKKJJOMQCNPGB-JTQLQIEISA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cryptotanshinone (CHEBI:149838) has role anticoronaviral agent (CHEBI:149553) |
| Cryptotanshinone (CHEBI:149838) is a abietane diterpenoid (CHEBI:36762) |
| Registry Numbers | Sources |
|---|---|
| CAS:35825-57-1 | ChemIDplus |