EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C63H113N11O12 |
| Net Charge | 0 |
| Average Mass | 1216.662 |
| Monoisotopic Mass | 1215.85702 |
| SMILES | [H][C@]1([C@H](O)[C@H](C)C/C=C/C)C(=O)N[C@@H](CC)C(=O)N(C)[C@H](C)C(=O)N(CC)[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N(C)[C@@H](C(C)C)C(=O)N1C |
| InChI | InChI=1S/C63H113N11O12/c1-26-29-30-40(16)52(75)51-56(79)66-44(27-2)59(82)68(20)43(19)58(81)74(28-3)49(38(12)13)55(78)67-48(37(10)11)62(85)69(21)45(31-34(4)5)54(77)64-41(17)53(76)65-42(18)57(80)70(22)46(32-35(6)7)60(83)71(23)47(33-36(8)9)61(84)72(24)50(39(14)15)63(86)73(51)25/h26,29,34-52,75H,27-28,30-33H2,1-25H3,(H,64,77)(H,65,76)(H,66,79)(H,67,78)/b29-26+/t40-,41+,42-,43-,44+,45+,46+,47+,48+,49+,50+,51+,52-/m1/s1 |
| InChIKey | OLROWHGDTNFZBH-XEMWPYQTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Alisporivir (CHEBI:149837) has role anticoronaviral agent (CHEBI:149553) |
| Alisporivir (CHEBI:149837) is a homodetic cyclic peptide (CHEBI:24613) |
| Synonym | Source |
|---|---|
| Alisporivir [USAN:INN] | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:254435-95-5 | ChemIDplus |