EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H33N7O3 |
| Net Charge | 0 |
| Average Mass | 515.618 |
| Monoisotopic Mass | 515.26449 |
| SMILES | CCC(C)(C)NC(=O)C(c1cccn1C)N(C(=O)Cn1nnc2ccccc21)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C28H33N7O3/c1-6-28(3,4)30-27(38)26(24-12-9-17-33(24)5)35(21-15-13-20(14-16-21)29-19(2)36)25(37)18-34-23-11-8-7-10-22(23)31-32-34/h7-17,26H,6,18H2,1-5H3,(H,29,36)(H,30,38) |
| InChIKey | BCIIGGMNYNWRQK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CID 3198732 (CHEBI:149834) has role anticoronaviral agent (CHEBI:149553) |
| CID 3198732 (CHEBI:149834) is a acetamides (CHEBI:22160) |
| CID 3198732 (CHEBI:149834) is a anilide (CHEBI:13248) |