EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H29N3O3 |
| Net Charge | 0 |
| Average Mass | 431.536 |
| Monoisotopic Mass | 431.22089 |
| SMILES | CC(C)c1ccc(N(C(=O)c2ccco2)C(C(=O)NC2CCCC2)c2cccnc2)cc1 |
| InChI | InChI=1S/C26H29N3O3/c1-18(2)19-11-13-22(14-12-19)29(26(31)23-10-6-16-32-23)24(20-7-5-15-27-17-20)25(30)28-21-8-3-4-9-21/h5-7,10-18,21,24H,3-4,8-9H2,1-2H3,(H,28,30) |
| InChIKey | NJGXLQREENWGGR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[2-(Cyclopentylamino)-2-oxo-1-pyridin-3-ylethyl]-N-(4-propan-2-ylphenyl)furan-2-carboxamide (CHEBI:149831) has role anticoronaviral agent (CHEBI:149553) |
| N-[2-(Cyclopentylamino)-2-oxo-1-pyridin-3-ylethyl]-N-(4-propan-2-ylphenyl)furan-2-carboxamide (CHEBI:149831) is a aromatic amide (CHEBI:62733) |
| N-[2-(Cyclopentylamino)-2-oxo-1-pyridin-3-ylethyl]-N-(4-propan-2-ylphenyl)furan-2-carboxamide (CHEBI:149831) is a furans (CHEBI:24129) |