EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H13NO3S2 |
| Net Charge | 0 |
| Average Mass | 355.440 |
| Monoisotopic Mass | 355.03369 |
| SMILES | O=C(/C=C/c1cccs1)Nc1scc(-c2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C18H13NO3S2/c20-15(9-8-13-7-4-10-23-13)19-17-16(18(21)22)14(11-24-17)12-5-2-1-3-6-12/h1-11H,(H,19,20)(H,21,22)/b9-8+ |
| InChIKey | BTURFDFZCYITAI-CMDGGOBGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-4-Phenyl-2-(3-(thiophen-2-yl)acrylamido)thiophene-3-carboxylic acid (CHEBI:149829) has role anticoronaviral agent (CHEBI:149553) |
| (E)-4-Phenyl-2-(3-(thiophen-2-yl)acrylamido)thiophene-3-carboxylic acid (CHEBI:149829) is a thiophenecarboxylic acid (CHEBI:48436) |