EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H8ClNO2.HCl |
| Net Charge | 0 |
| Average Mass | 270.115 |
| Monoisotopic Mass | 269.00103 |
| SMILES | Cl.O=C(Oc1cccnc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H8ClNO2.ClH/c13-10-5-3-9(4-6-10)12(15)16-11-2-1-7-14-8-11;/h1-8H;1H |
| InChIKey | IILDQBBNCMYHPD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hydron;pyridin-3-yl 4-chlorobenzoate;chloride (CHEBI:149828) has role anticoronaviral agent (CHEBI:149553) |
| Hydron;pyridin-3-yl 4-chlorobenzoate;chloride (CHEBI:149828) is a benzoate ester (CHEBI:36054) |