EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H32N6O5 |
| Net Charge | 0 |
| Average Mass | 556.623 |
| Monoisotopic Mass | 556.24342 |
| SMILES | COc1ccc(C(C(=O)NCC2CCCO2)N(C(=O)Cn2nnc3ccccc32)c2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C30H32N6O5/c1-20(37)32-22-11-13-23(14-12-22)36(28(38)19-35-27-8-4-3-7-26(27)33-34-35)29(21-9-15-24(40-2)16-10-21)30(39)31-18-25-6-5-17-41-25/h3-4,7-16,25,29H,5-6,17-19H2,1-2H3,(H,31,39)(H,32,37) |
| InChIKey | KMZDAUWGOMFZCP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CID 3191469 (CHEBI:149827) has role anticoronaviral agent (CHEBI:149553) |
| CID 3191469 (CHEBI:149827) is a acetamides (CHEBI:22160) |
| CID 3191469 (CHEBI:149827) is a anilide (CHEBI:13248) |