EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13N3O |
| Net Charge | 0 |
| Average Mass | 263.300 |
| Monoisotopic Mass | 263.10586 |
| SMILES | O=Cc1cn(Cc2ccccc2)nc1-c1cccnc1 |
| InChI | InChI=1S/C16H13N3O/c20-12-15-11-19(10-13-5-2-1-3-6-13)18-16(15)14-7-4-8-17-9-14/h1-9,11-12H,10H2 |
| InChIKey | WLALNLLKMJDSEF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-Benzyl-3-pyridin-3-yl-1H-pyrazole-4-carbaldehyde (CHEBI:149826) has role anticoronaviral agent (CHEBI:149553) |
| 1-Benzyl-3-pyridin-3-yl-1H-pyrazole-4-carbaldehyde (CHEBI:149826) is a pyrazolopyridine (CHEBI:46699) |