EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25ClN4OS |
| Net Charge | 0 |
| Average Mass | 392.956 |
| Monoisotopic Mass | 392.14376 |
| SMILES | CCc1nc(N2CCN(C(=O)CCl)CC2)c2c3c(sc2n1)CC(C)CC3 |
| InChI | InChI=1S/C19H25ClN4OS/c1-3-15-21-18(24-8-6-23(7-9-24)16(25)11-20)17-13-5-4-12(2)10-14(13)26-19(17)22-15/h12H,3-11H2,1-2H3 |
| InChIKey | BOUWNGNDHMQJOU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CID 3192987 (CHEBI:149823) has role anticoronaviral agent (CHEBI:149553) |
| CID 3192987 (CHEBI:149823) is a N-arylpiperazine (CHEBI:46848) |